MeKO Metabolites

Information:
Metabolite name 3-amino-Piperidin-2-one
Synonymous or Abbreviation piperidin-2-one, 3-amino- (2tms)|piperidin-2-one, 3-amino-
CAS 34294-79-6|32565-12-1
KEGG
KEGG Map NA
AraCyc link
PubChem 7200369
ChEBI
LipidMaps
LipidBank
GMD m000728
KNApSAcK
InChI InChI=1S/C5H10N2O/c6-4-2-1-3-7-5(4)8/h4H,1-3,6H2,(H,7,8)/t4-/m0/s1