MeKO Metabolites

Information:
Metabolite name 4-amino-Butyric acid
Synonymous or Abbreviation 4-aminobutyric acid|4-aminobutanoate|4-aminobutanoic acid|gamma-amino-n-butyric acid|butyric acid, 4-amino-|gamma-aminobutyric acid|butyric acid, 4-amino- (3tms)|butyric acid, 4-amino- (2tms)|4-aminobutyrate|4-aminobutylate|g-aminobutyric acid|gaba
CAS 56-12-2|39538-11-9|39508-23-1
KEGG c00334
KEGG Map 00220
AraCyc link
PubChem nil
ChEBI 16865
LipidMaps lmfa01100039
LipidBank
GMD m000114
KNApSAcK C00001337
InChI InChI=1/C4H9NO2/c5-3-1-2-4(6)7/h1-3,5H2,(H,6,7)/f/h6H