MeKO Metabolites

Information:
Metabolite name 9,12-(Z,Z)-n-Octadecadienoic acid
Synonymous or Abbreviation linoleic acid|octadecadienoic acid, 9,12-(z,z)-, n-|linoleate|(9z,12z)-octadecadienoic acid|octadecadienoic acid, 9,12-(z,z)-, n- (1tms)|9-cis,12-cis-octadecadienoate|9-cis,12-cis-octadecadienoic acid
CAS 8024-22-4|60-33-3
KEGG c01595
KEGG Map 00591
AraCyc link
PubChem 5280450
ChEBI 17351
LipidMaps lmfa01030120
LipidBank dfa0159
GMD m000488
KNApSAcK C00001224
InChI InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6-,10-9-/f/h19H