MeKO Metabolites

Information:
Metabolite name D-Maltose
Synonymous or Abbreviation alpha-maltose|1-alpha-d-glucopyranosyl-4-alpha-d-glucopyranose|alpha-malt sugar|malt sugar|maltose|maltose, d- (1meox)|maltose, d- (1meox) (8tms)|d-maltose
CAS 4482-75-1|69-79-4|6363-53-7
KEGG d05373
KEGG Map 02060|02010|02031
AraCyc link
PubChem nil
ChEBI 18167
LipidMaps
LipidBank
GMD m000048
KNApSAcK C00001140
InChI InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11+,12-/m1/s1|InChI=1/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11?,12-/m1/s1