MeKO Metabolites

Information:
Metabolite name D-Ribitol
Synonymous or Abbreviation d-arabitol|adonitol|d-lyxitol|eutrit|arabitol, d- (5tms)|ribitol, d-|newtol|d-arabinol|xyliton|xylitol?|ribitol|xylosic alcohol|ribitol, d- (5tms)|d-arabinitol|xylitol|xylisorb|xylitol (5tms)|xylite|wood sugar alcohol|kylit|arabitol, d-
CAS 488-82-4|14199-73-6|14199-72-5|84709-42-2|7313-55-5|12426-00-5|32381-53-6|488-81-3|87-99-0|37191-59-6|75398-81-1|2152-56-9
KEGG d00061
KEGG Map 00040|00740
AraCyc link
PubChem nil
ChEBI 18333
LipidMaps
LipidBank
GMD m000155
KNApSAcK C00001171
InChI InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5-|InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5?|InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2|InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5+|InChI=1/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4-/m1/s1