MeKO Metabolites

Information:
Metabolite name DL-Cysteine
Synonymous or Abbreviation cys|cysteine, dl- (3tms)|cysteine2_3tms|d-amino-3-mercaptopropionic acid|cysteine, dl-|d-cysteine|cysteine|2-amino-3-mercaptopropionic acid|l-2-amino-3-mercaptopropionic acid|l-cysteine
CAS 4371-52-2|3374-22-9|52-90-4|921-01-7|7364-50-3
KEGG c00736
KEGG Map 00970|00770|00730|00311|00272|00260|00271|00430|00480|00460|00920
AraCyc link
PubChem nil
ChEBI 16375
LipidMaps
LipidBank
GMD m000020
KNApSAcK C00007323
InChI InChI=1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1/f/h5H|InChI=1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/f/h5H|InChI=1/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m1/s1/f/h5H