MeKO Metabolites

Information:
Metabolite name DL-Isocitric acid
Synonymous or Abbreviation (1s,2s)-1-hydroxypropane-1,2,3-tricarboxylate|isocitric acid, dl- (4tms)|1-hydroxypropane-1,2,3-tricarboxylic acid|isocitric acid|d-threo-isocitric acid|isocitrate|d-erythro-isocitric acid|dl-isocitric acid|(1r,2s)-1-hydroxypropane-1,2,3-tricarboxylate|isocitric acid, dl-|1-hydroxytricarballylic acid
CAS 30810-51-6|320-77-4|6061-97-8|1637-73-6|55517-57-2
KEGG c00451
KEGG Map 01061|00630
AraCyc link
PubChem nil
ChEBI 151
LipidMaps
LipidBank
GMD m000608
KNApSAcK C00001188
InChI InChI=1/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/t2-,4+/m1/s1/f/h7,10,12H|InChI=1/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/t2-,4-/m0/s1/f/h7,10,12H|InChI=1/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/t2-,4-/m1/s1/f/h7,10,12H|InChI=1/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/f/h7,10,12H|InChI=1/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/t2-,4+/m0/s1/f/h7,10,12H