MeKO Metabolites

Information:
Metabolite name DL-Lactic acid
Synonymous or Abbreviation d-2-hydroxypropionic acid|lactic acid, dl- (2tms)|d-lactic acid|2-hydroxypropionic acid|d-2-hydroxypropanoic acid|lactate|lactic acid|l-lactate|(r)-lactate|lactic acid, dl-|2-hydroxypropanoic acid|(s)-lactate|d-lactate|l-lactic acid
CAS 10326-41-7|598-82-3|50-21-5|17596-96-2|79-33-4
KEGG c00186
KEGG Map 00643
AraCyc link
PubChem nil
ChEBI 422
LipidMaps
LipidBank dfa0268
GMD m000100
KNApSAcK C00019549
InChI InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/f/h5H|InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m1/s1/f/h5H|InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1/f/h5H