MeKO Metabolites

Information:
Metabolite name DL-Methionine
Synonymous or Abbreviation methionine, dl- (2tms)|d-methionine|methionine, dl- (1tms)|l-2-amino-4methylthiobutyric acid|l-methionine|d-2-amino-4-(methylthio)butyric acid|met|2-amino-4-(methylthio)butyric acid|methionine|methionine2_2tms|methionine, dl-
CAS 348-67-4|7005-18-7|27844-10-6|59-51-8|63-68-3
KEGG c00073
KEGG Map 00271
AraCyc link
PubChem 6137
ChEBI 16811
LipidMaps
LipidBank
GMD m000018
KNApSAcK C00001379
InChI InChI=1/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m1/s1/f/h7H|InChI=1/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/f/h7H|InChI=1/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1/f/h7H