MeKO Metabolites

Information:
Metabolite name DL-Ornithine
Synonymous or Abbreviation 2,5-diaminovaleric acid|ornithine, l-|ornithine, dl- (5tms)|ornithine, dl- (4tms)|ornithine, l- (3tms)|d-ornithine|ornithine|(s)-2,5-diaminovaleric acid|(s)-2,5-diaminopentanoate|ornithine, dl-|l-ornithine|ornithine, l- (4tms)|ornithine, dl- (3tms)|2,5-diaminopentanoate|2,5-diaminopentanoic acid|(s)-2,5-diaminopentanoic acid
CAS 7006-33-9|24595-70-8|3184-13-2|55556-70-2|70-26-8|348-66-3|616-07-9
KEGG c01602
KEGG Map 00220|00330|00472|00480
AraCyc link
PubChem nil
ChEBI 15729
LipidMaps
LipidBank
GMD m000028
KNApSAcK C00001384
InChI InChI=1/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m1/s1/f/h8H|InChI=1/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/t4-/m0/s1/f/h8H|InChI=1/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9)/f/h8H