MeKO Metabolites

Information:
Metabolite name DL-Phenylalanine
Synonymous or Abbreviation phenylalanine, dl- (2tms)|d-phenylalanine|phenylalanine, dl- (1tms)|d-alpha-amino-beta-phenylpropionic acid|phe|(s)-alpha-amino-beta-phenylpropionic acid|l-phenylalanine|phenylalanine, dl-
CAS 673-06-3|150-30-1|7364-51-4|3617-44-5|2899-42-5|63-91-2|2899-52-7
KEGG c00079
KEGG Map 00940|00400|00960|00970
AraCyc link
PubChem 6140
ChEBI 17295
LipidMaps
LipidBank
GMD m000011
KNApSAcK C00001386
InChI InChI=1/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m1/s1/f/h11H|InChI=1/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/f/h11H|InChI=1/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/f/h11H