MeKO Metabolites

Information:
Metabolite name DL-Threonine
Synonymous or Abbreviation d-threonine|threonine, allo-, dl-|d-2-amino-3-hydroxybutyric acid|thr|threonine, allo-, dl- (3tms)|threonine, dl-|l-allothreonine|l-threonine|l-allo-threonine|2-amino-3-hydroxybutyric acid|threonine, dl- (3tms)|threonine, dl- (2tms)
CAS 64569-35-3|7536-82-5|80-68-2|72-19-5|24830-94-2|632-20-2|144-98-9|28954-12-3|7537-02-2
KEGG c12317
KEGG Map 00860
AraCyc link
PubChem nil
ChEBI 16857
LipidMaps
LipidBank
GMD m000016
KNApSAcK C00001394
InChI InChI=1/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3-/m1/s1/f/h7H|InChI=1/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1/f/h7H|InChI=1/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3-/m0/s1/f/h7H|InChI=1/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m0/s1/f/h7H