MeKO Metabolites

Information:
Metabolite name Fumaric acid
Synonymous or Abbreviation fumarate|fumaric acid (2tms)|fumaric acid and succinis acid(mixture)|fumaric acid|trans-butenedioic acid|fumarate_2tms
CAS 7704-73-6|17962-03-7|110-17-8
KEGG c00122
KEGG Map 00330|00632|02020|05211|00190|00760|00650|00350|00643|00220|00251
AraCyc link
PubChem 444972
ChEBI 18012
LipidMaps
LipidBank
GMD m000067
KNApSAcK C00001183
InChI InChI=1/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+/f/h5,7H