MeKO Metabolites

Information:
Metabolite name Galactinol
Synonymous or Abbreviation galactinol (9tms)|galactinol|1-o-alpha-d-galactosyl-d-myo-inositol|1-alpha-d-galactosyl-myo-inositol
CAS 16908-86-4|3687-64-7
KEGG c01235
KEGG Map 00052
AraCyc link
PubChem nil
ChEBI 17505
LipidMaps
LipidBank
GMD m000673
KNApSAcK C00001162
InChI InChI=1/C12H22O11/c13-1-2-3(14)4(15)10(21)12(22-2)23-11-8(19)6(17)5(16)7(18)9(11)20/h2-21H,1H2/t2-,3+,4+,5?,6-,7+,8-,9-,10-,11?,12-/m1/s1|InChI=1/C12H22O11/c13-1-2-3(14)4(15)10(21)12(22-2)23-11-8(19)6(17)5(16)7(18)9(11)20/h2-21H,1H2/t2-,3+,4+,5-,6-,7+,8+,9+,10-,11-,12-/m1/s1