MeKO Metabolites

Information:
Metabolite name Gluconic acid
Synonymous or Abbreviation gluconic acid (6tms)|d-gluconate|gluconate|gluconic acid|d-gluconic acid|d-gluco-hexonic acid
CAS 527-07-1|34290-52-3|526-95-4
KEGG d05862
KEGG Map 00030
AraCyc link
PubChem nil
ChEBI 33198
LipidMaps
LipidBank
GMD m000508
KNApSAcK C00007303
InChI InChI=1/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4+,5-/m1/s1/f/h12H