MeKO Metabolites

Information:
Metabolite name Glucose
Synonymous or Abbreviation glucose, d- (1meox) (5tms)|d-glucose|alpha-d-glucose|beta-d-glucose|glucose_maj_1meox_5tms|glucose, d- (1meox)|grape sugar|glucose1|dextrose|beta-d-(+)-glucose|glucose|d-(+)-glucose|glucopyranose, d- (5tms)|glucopyranose, d-
CAS 50-99-7|53991-51-8|34152-44-8|19126-99-9|492-61-5|492-62-6
KEGG c00267
KEGG Map 00051|00901|04930|02060|02010|00500|00521|00010|00052|01061|04910|00030|02020
AraCyc link
PubChem nil
ChEBI 4167
LipidMaps
LipidBank
GMD m000040
KNApSAcK C00001122
InChI InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m1/s1|InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6u/m1/s1|InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6-/m0/s1|InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1|InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m0/s1|InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6-/m1/s1