MeKO Metabolites

Information:
Metabolite name Glutaric acid
Synonymous or Abbreviation 1,3-propanedicarboxylic acid|glutaric acid (2tms)|1.3-propanedicarboxylic acid|glutaric acid|glutarate|pentanedioic acid
CAS 55494-07-0|3343-88-2|7364-81-0|111-16-0|110-94-1
KEGG c00489
KEGG Map 00071|00310
AraCyc link
PubChem 743
ChEBI 17859
LipidMaps lmfa01170046
LipidBank
GMD m000102
KNApSAcK C00001184
InChI InChI=1/C5H8O4/c6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7)(H,8,9)/f/h6,8H