MeKO Metabolites

Information:
Metabolite name Glycolic acid
Synonymous or Abbreviation glycolic acid (2tms)|glycolate|glycolic acid|hydroxyacetic acid
CAS 33581-77-0|996-23-6|79-14-1
KEGG c03547
KEGG Map 00361|00630|00631
AraCyc link
PubChem nil
ChEBI 17497
LipidMaps lmfa01050148
LipidBank dfa0267
GMD m000517
KNApSAcK C00007461
InChI InChI=1/C2H4O3/c3-1-2(4)5/h3H,1H2,(H,4,5)/f/h4H