MeKO Metabolites

Information:
Metabolite name L-Cystine
Synonymous or Abbreviation dicysteine|l-cystine|l-alpha-diamino-beta-dithiolactic acid|alpha-diamino-beta-dithiolactic acid|l-dicysteine|cystine, l- (4tms)|cystine|cystine, l-
CAS 69688-44-4|349-46-2|56-89-3|923-32-0|24645-67-8
KEGG c01420
KEGG Map m000661_a241002-101_metb_2293_eigtms_cystine, l- (4tms)|m000661_a241002-101_metb_2283.3_eimor_cystine, l- (4tms)|m000661_a241002-101_metb_2296_eigtms_cystine, l- (4tms)|m000661_a241002-101_metb_792120_eiboel_cystine, l- (4tms)
AraCyc link
PubChem 67678
ChEBI c00001352
LipidMaps InChI=1/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m0/s1/f/h9,11H
LipidBank NC(CSSCC(N)C(O)=O)C(O)=O
GMD
KNApSAcK 2'S)-3
InChI 3'-disulfanediylbis(2-aminopropanoic acid)|(2s