MeKO Metabolites

Information:
Metabolite name L-Tyrosine
Synonymous or Abbreviation tyrosine|l-tyrosine|tyrosine, l-|3-(p-hydroxyphenyl)alanine|dl-tyrosine|(r)-3-(p-hydroxyphenyl)alanine|d-tyrosine|(s)-3-(p-hydroxyphenyl)alanine|(r)-2-amino-3-(p-hydroxyphenyl)propionic acid|tyrosine, dl- (3tms)|tyrosine, dl- (2tms)|tyrosine, dl-|tyrosine, l- (3tms)|2-amino-3-(p-hydroxyphenyl)propionic acid|tyr|(s)-2-amino-3-(p-hydroxyphenyl)propionic acid
CAS 556-03-6|556-02-5|55520-40-6|51220-73-6|7536-83-6|60-18-4|7415-19-2
KEGG c00082
KEGG Map 00400|00940|00950|00401|00350|05012|01055|04916
AraCyc link
PubChem nil
ChEBI 28479
LipidMaps
LipidBank
GMD m000035
KNApSAcK C00001397
InChI InChI=1/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m1/s1/f/h12H|InChI=1/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/f/h12H|InChI=1/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/f/h12H