MeKO Metabolites

Information:
Metabolite name Maltitol
Synonymous or Abbreviation maltitol (9tms)|maltitol
CAS 585-88-6|97906-38-2
KEGG d04845
KEGG Map NA
AraCyc link
PubChem nil
ChEBI
LipidMaps
LipidBank
GMD m000058
KNApSAcK
InChI InChI=1/C12H24O11/c13-1-4(16)7(18)11(5(17)2-14)23-12-10(21)9(20)8(19)6(3-15)22-12/h4-21H,1-3H2/t4-,5+,6+,7+,8+,9-,10+,11+,12+/m0/s1