MeKO Metabolites

Information:
Metabolite name Nicotinic acid
Synonymous or Abbreviation niacin|nicotinate|nicotinic acid|3-pyridinecarboxylic acid|nicotinic acid (1tms)
CAS 636-79-3|59-67-6|25436-37-7
KEGG c00253
KEGG Map 00960|00760
AraCyc link
PubChem nil
ChEBI 15940
LipidMaps
LipidBank
GMD m000457
KNApSAcK C00000208
InChI InChI=1/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)/f/h8H