MeKO Metabolites

Information:
Metabolite name Phytol
Synonymous or Abbreviation phytol|phytol (1tms)
CAS 150-86-7|7541-49-3|57397-39-4
KEGG c01389
KEGG Map NA
AraCyc link
PubChem nil
ChEBI 17327
LipidMaps lmpr0104010002
LipidBank
GMD m000764
KNApSAcK C00003467
InChI InChI=1/C20H40O/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h15,17-19,21H,6-14,16H2,1-5H3/b20-15+/t18-,19-/m1/s1