MeKO Metabolites

Information:
Metabolite name Saccharic acid
Synonymous or Abbreviation d-glucaric acid|saccharic acid (6tms)|glucaric acid|saccharic acid|d-glucosaccharic acid|d-saccharic acid|d-glucarate|glucarate|l-gularic acid
CAS 38165-96-7|87-73-0|576-42-1|5793-88-4|25525-21-7
KEGG c00818
KEGG Map 00053
AraCyc link
PubChem nil
ChEBI 16002
LipidMaps
LipidBank
GMD m000093
KNApSAcK
InChI InChI=1/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2-,3-,4+/m1/s1/f/h11,13H|InChI=1/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2-,3-,4+/m0/s1/f/h11,13H