MeKO Metabolites

Information:
Metabolite name Shikimic acid
Synonymous or Abbreviation 3,4,5-trihydroxy-1-cyclohexenecarboxylic acid|shikimic acid (4tms)|shikimate|(-)-shikimic acid|shikimate_4tms|shikimic acid
CAS 138-59-0|55520-78-0
KEGG c00493
KEGG Map NA
AraCyc link
PubChem 8742
ChEBI 16119
LipidMaps
LipidBank
GMD m000607
KNApSAcK C00001203
InChI InChI=1/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/t4-,5-,6-/m1/s1/f/h11H|InChI=1/C7H10O5/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1,4-6,8-10H,2H2,(H,11,12)/f/h11H