MeKO Metabolites

Information:
Metabolite name Suberic acid
Synonymous or Abbreviation suberic acid (2tms)|suberic acid|1,6-hexanedicarboxylic acid|octanedioic acid|1,8-octanedioic acid|cork acid
CAS 505-48-6|43199-48-0
KEGG c08278
KEGG Map NA
AraCyc link
PubChem 10457
ChEBI 9300
LipidMaps lmfa01170001
LipidBank
GMD m000229
KNApSAcK C00001204
InChI InChI=1/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12)/f/h9,11H