MeKO Metabolites

Information:
Metabolite name Sucrose
Synonymous or Abbreviation sucrose, d- (8tms)|1-alpha-d-glucopyranosyl-2-beta-d-fructofuranoside|sucrose, d-|cane sugar|d-sucrose|sucrose_8tms|sucrose|saccharose
CAS 57-50-1|19159-25-2
KEGG d00025
KEGG Map 00052|04742
AraCyc link
PubChem nil
ChEBI 17992
LipidMaps
LipidBank
GMD m000044
KNApSAcK C00001151
InChI InChI=1/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1