MeKO Metabolites

Information:
Metabolite name Threonic acid
Synonymous or Abbreviation threonic acid|l-threonic acid hemicalcium salt|threonate|l-threonic acid|l-threonate|threonic acid (4tms)|(2r,3s)-2,3,4-trihydroxybutyric acid
CAS 3909-12-4|7306-96-9|38191-88-7|70753-61-6
KEGG c01620
KEGG Map 00053
AraCyc link
PubChem nil
ChEBI 26984
LipidMaps
LipidBank dfa0363
GMD m000078
KNApSAcK
InChI InChI=1/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/t2-,3+/m0/s1/f/h8H|InChI=1/C4H8O5/c5-1-2(6)3(7)4(8)9/h2-3,5-7H,1H2,(H,8,9)/t2-,3+/m1/s1/f/h8H