MeKO Metabolites

Information:
Metabolite name Tryptamine
Synonymous or Abbreviation 3-(2-aminoethyl)indole|tryptamine (3tms)|3-(2-aminoethyl)indole [tryptamine]|tryptamine
CAS 343-94-2|61-54-1|55334-17-3
KEGG c00398
KEGG Map 04080|00900|00901
AraCyc link
PubChem nil
ChEBI 16765
LipidMaps
LipidBank
GMD m000175
KNApSAcK C00001434
InChI InChI=1/C10H12N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6,11H2