MeKO Metabolites

Information:
Metabolite name beta-Alanine
Synonymous or Abbreviation alanine, beta- (1tms)|alanine, beta-|3-aminopropionic acid|b-ala|3-aminopropanoate|alanine, beta- (3tms)|alanine, beta- (2tms)|b-alanine|beta-alanine
CAS 5269-40-9|17891-86-0|16690-93-0|107-95-9|55255-77-1
KEGG c00099
KEGG Map 04080|00410|00770|00640
AraCyc link
PubChem nil
ChEBI 16958
LipidMaps
LipidBank
GMD m000027
KNApSAcK C00001333
InChI InChI=1/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6)/f/h5H