MeKO Metabolites

Information:
Metabolite name cis-Aconitic acid
Synonymous or Abbreviation trans-aconitic acid|aconitic acid, cis- (3tms)|trans-aconitate|cis-aconitic acid|aconitic acid, cis-|cis-aconitate
CAS 585-84-2|4023-65-8|55530-71-7
KEGG c00417
KEGG Map 00720|00630
AraCyc link
PubChem nil
ChEBI 32805
LipidMaps
LipidBank
GMD m000113
KNApSAcK C00001177
InChI InChI=1/C6H6O6/c7-4(8)1-3(6(11)12)2-5(9)10/h1H,2H2,(H,7,8)(H,9,10)(H,11,12)/b3-1+/f/h7,9,11H|InChI=1/C6H6O6/c7-4(8)1-3(6(11)12)2-5(9)10/h1H,2H2,(H,7,8)(H,9,10)(H,11,12)/b3-1-/f/h7,9,11H