MeKO Metabolites

Information:
Metabolite name cis-Sinapic acid
Synonymous or Abbreviation sinapic acid, cis-|sinapic acid, cis- (2tms)
CAS 530-59-6
KEGG C00482
KEGG Map 00940|01061|01100|01110
AraCyc link
PubChem 1549091
ChEBI 589794
LipidMaps
LipidBank
GMD m000648
KNApSAcK C00002776
InChI InChI=1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3-